Lipid Signaling in Plants (eBook, PDF)

Redaktion: Munnik, Teun

• Format: PDF

Produktbeschreibung

advancedlipidologists. PartIincludesphospholipases(Chaps. 1-3),partII,lipid kinases (Chaps. 4-7), part III, lipid phosphatases (Chaps. 8-9), part IV, ix x Preface inositolphosphates and PPI metabolism (Chaps. 10-13), part V, PA signaling (Chaps. 14-17),andpartVI,additionallipidsignals,e. g. oxylipins,NAPEand sphingolipids(Chaps18-20). Ithasbeenagreatpleasuretobetheeditorofthis bookandtobeawitnessofthislipid-signalingadventure. Amsterdam,June2009 TeunMunnik Contents PartI Phospholipases PhospholipaseAinPlantSignalTransduction. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 3 Gu¿ntherF. E. Scherer TheEmergingRolesofPhospholipaseCinPlantGrowth andDevelopment. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 23 PeterE. DowdandSimonGilroy PlantPhospholipaseD. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 39 WenhuaZhang,XiaoboWan,YueyunHong,WeiqiLi,andXueminWang PartII Kinases Phosphatidylinositol4-PhosphateisRequiredforTip GrowthinArabidopsisthaliana . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 65 AmyL. SzumlanskiandErikNielsen PIP-KinasesasKeyRegulatorsofPlantFunction . . . . . . . . . . . . . . . . . . . . . . . . . . . 79 TillIschebeckandIngoHeilmann PlantPhosphatidylinositol3-Kinase. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 95 YureeLee,TeunMunnik,andYoungsookLee DiacylglycerolKinase. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 107 StevenA. AriszandTeunMunnik xi xii Contents PartIII Phosphatases SignalingandthePolyphosphoinositidePhosphatasesfromPlants . . . . . . 117 GlendaE. Gillaspy PhosphatidicAcidPhosphatasesinSeedPlants. . . . . . . . . . . . . . . . . . . . . . . . . . . . 131 YukiNakamuraandHiroyukiOhta PartIV PPIMetabolism InsP inPlantCells . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 145 3 YangJuIm,BrianQPhillippy,andImaraYPerera InositolPolyphosphatesandKinases. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 161 JillStevenson-PaulikandBrianQ. Phillippy PhosphoinositidesandPlantCellWallSynthesis . . . . . . . . . . . . . . . . . . . . . . . . . . 175 RuiqinZhong,RyanL. McCarthy,andZheng-HuaYe ImagingLipidsinLivingPlants . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 185 JoopE. M. VermeerandTeunMunnik PartV PASignaling PhosphatidicAcid:AnElectrostatic/Hydrogen-BondSwitch?. . . . . . . . . . . . 203 EdgarEduardKooijmanandChristaTesterink NitricOxideandPhosphatidicAcidSignalinginPlants. . . . . . . . . . . . . . . . . . . 223 AyelenM. Diste¿fano,M. LucianaLanteri,ArjentenHave, CarlosGarc?¿a-Mata,LorenzoLamattina,andAnaM. Laxalt 3-Phosphoinositide-DependentProteinKinaseisaSwitchboard fromSignalingLipidstoProteinPhosphorylationCascades. . . . . . . . . . . . . . 243 ChristineZalejskiandLa¿szlo¿Bo¿gre PartVI AdditionalLipidSignals DiacylglycerolPyrophosphate,ANovelPlantSignalingLipid. . . . . . . . . . . . 263 EmmanuelleJeannette,SophieParadis,andChristineZalejski OxylipinSignalingandPlantGrowth. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 277 AlinaMosblech,IvoFeussner,andIngoHeilmann Contents xiii FattyAcidAmideHydrolaseandtheMetabolismof N-AcylethanolamineLipidMediatorsinPlants. . . . . . . . . . . . . . . . . . . . . . . . . . . . 293 KentD. ChapmanandElisonB. Blanca?or SphingolipidSignalinginPlants. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 307 LouiseV. MichaelsonandJohnathanA. Napier Index . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . 323 Contributors Steven A. Arisz Section Plant Physiology, Swammerdam Institute for Life Sciences,UniversityofAmsterdam,SciencePark904,NL-1098XH,Amsterdam, TheNetherlands ElisonB. Blanca?or SamuelRobertsNobleFoundation,PlantBiologyDivision, Ardmore,OK73401,USA,eblanca?or@noble.

---

Dieser Download kann aus rechtlichen Gründen nur mit Rechnungsadresse in A, B, BG, CY, CZ, D, DK, EW, E, FIN, F, GR, HR, H, IRL, I, LT, L, LR, M, NL, PL, P, R, S, SLO, SK ausgeliefert werden.

Produktdetails

• Verlag: Springer Berlin Heidelberg
• Seitenzahl: 330
• Erscheinungstermin: 3. Dezember 2009
• Englisch
• ISBN-13: 9783642038730
• Artikelnr.: 37375099

Inhaltsangabe

Phospholipases.- Phospholipase A in Plant Signal Transduction.- The Emerging Roles of Phospholipase C in Plant Growth and Development.- Plant Phospholipase D.- Kinases.- Phosphatidylinositol 4-Phosphate is Required for Tip Growth in Arabidopsis thaliana.- PIP-Kinases as Key Regulators of Plant Function.- Plant Phosphatidylinositol 3-Kinase.- Diacylglycerol Kinase.- Phosphatases.- Signaling and the Polyphosphoinositide Phosphatases from Plants.- Phosphatidic Acid Phosphatases in Seed Plants.- PPI Metabolism.- InsP3 in Plant Cells.- Inositol Polyphosphates and Kinases.- Phosphoinositides and Plant Cell Wall Synthesis.- Imaging Lipids in Living Plants.- PA Signaling.- Phosphatidic Acid: An Electrostatic/Hydrogen-Bond Switch?.- Nitric Oxide and Phosphatidic Acid Signaling in Plants.- 3-Phosphoinositide-Dependent Protein Kinase is a Switchboard from Signaling Lipids to Protein Phosphorylation Cascades.- Diacylglycerol Pyrophosphate, A Novel Plant Signaling Lipid.- Additional Lipid Signals.- Oxylipin Signaling and Plant Growth.- Fatty Acid Amide Hydrolase and the Metabolism of N-Acylethanolamine Lipid Mediators in Plants.- Sphingolipid Signaling in Plants.